About 2-(1,4-diazepan-1-yl)-2-(oxan-3-yl)acetonitrile
2-(1,4-diazepan-1-yl)-2-(oxan-3-yl)acetonitrile (PubChem CID 63740061) has the molecular formula C12H21N3O
and a molecular weight of 223.32 g/mol. Its IUPAC name is 2-(1,4-diazepan-1-yl)-2-(oxan-3-yl)acetonitrile.
Molecular Properties
| Compound Name | 2-(1,4-diazepan-1-yl)-2-(oxan-3-yl)acetonitrile |
| PubChem CID | 63740061 |
| Molecular Formula | C12H21N3O |
| Molecular Weight | 223.32 g/mol |
| Exact Mass | 223.17 |
| IUPAC Name | 2-(1,4-diazepan-1-yl)-2-(oxan-3-yl)acetonitrile |
| SMILES | N#CC(C1CCCOC1)N1CCCNCC1 |
| InChI | InChI=1S/C12H21N3O/c13-9-12(11-3-1-8-16-10-11)15-6-2-4-14-5-7-15/h11-12,14H,1-8,10H2 |
| InChIKey | ADPNGDGCEKJAPU-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 48.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 223.32 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 2-(1,4-diazepan-1-yl)-2-(oxan-3-yl)acetonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(1,4-diazepan-1-yl)-2-(oxan-3-yl)acetonitrile?
The IUPAC name of 2-(1,4-diazepan-1-yl)-2-(oxan-3-yl)acetonitrile (CID 63740061) is 2-(1,4-diazepan-1-yl)-2-(oxan-3-yl)acetonitrile.
What is the SMILES notation for 2-(1,4-diazepan-1-yl)-2-(oxan-3-yl)acetonitrile?
The canonical SMILES for 2-(1,4-diazepan-1-yl)-2-(oxan-3-yl)acetonitrile is N#CC(C1CCCOC1)N1CCCNCC1.
What is the InChIKey of 2-(1,4-diazepan-1-yl)-2-(oxan-3-yl)acetonitrile?
The InChIKey is ADPNGDGCEKJAPU-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H21N3O/c13-9-12(11-3-1-8-16-10-11)15-6-2-4-14-5-7-15/h11-12,14H,1-8,10H2.
What are the key properties of 2-(1,4-diazepan-1-yl)-2-(oxan-3-yl)acetonitrile?
2-(1,4-diazepan-1-yl)-2-(oxan-3-yl)acetonitrile has a molecular weight of 223.32 g/mol, XLogP of 0.60, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(1,4-diazepan-1-yl)-2-(oxan-3-yl)acetonitrile is sourced from PubChem (CID 63740061), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).