About N-[[3-[[propyl(2,2,2-trifluoroethyl)amino]methyl]oxan-3-yl]methyl]cyclopropanamine
N-[[3-[[propyl(2,2,2-trifluoroethyl)amino]methyl]oxan-3-yl]methyl]cyclopropanamine (PubChem CID 63740316) has the molecular formula C15H27F3N2O
and a molecular weight of 308.39 g/mol. Its IUPAC name is N-[[3-[[propyl(2,2,2-trifluoroethyl)amino]methyl]oxan-3-yl]methyl]cyclopropanamine.
Molecular Properties
| Compound Name | N-[[3-[[propyl(2,2,2-trifluoroethyl)amino]methyl]oxan-3-yl]methyl]cyclopropanamine |
| PubChem CID | 63740316 |
| Molecular Formula | C15H27F3N2O |
| Molecular Weight | 308.39 g/mol |
| Exact Mass | 308.21 |
| IUPAC Name | N-[[3-[[propyl(2,2,2-trifluoroethyl)amino]methyl]oxan-3-yl]methyl]cyclopropanamine |
| SMILES | CCCN(CC(F)(F)F)CC1(CNC2CC2)CCCOC1 |
| InChI | InChI=1S/C15H27F3N2O/c1-2-7-20(11-15(16,17)18)10-14(6-3-8-21-12-14)9-19-13-4-5-13/h13,19H,2-12H2,1H3 |
| InChIKey | BTSCQYMXRCDZMR-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 24.50 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 308.39 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-[[3-[[propyl(2,2,2-trifluoroethyl)amino]methyl]oxan-3-yl]methyl]cyclopropanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[[3-[[propyl(2,2,2-trifluoroethyl)amino]methyl]oxan-3-yl]methyl]cyclopropanamine?
The IUPAC name of N-[[3-[[propyl(2,2,2-trifluoroethyl)amino]methyl]oxan-3-yl]methyl]cyclopropanamine (CID 63740316) is N-[[3-[[propyl(2,2,2-trifluoroethyl)amino]methyl]oxan-3-yl]methyl]cyclopropanamine.
What is the SMILES notation for N-[[3-[[propyl(2,2,2-trifluoroethyl)amino]methyl]oxan-3-yl]methyl]cyclopropanamine?
The canonical SMILES for N-[[3-[[propyl(2,2,2-trifluoroethyl)amino]methyl]oxan-3-yl]methyl]cyclopropanamine is CCCN(CC(F)(F)F)CC1(CNC2CC2)CCCOC1.
What is the InChIKey of N-[[3-[[propyl(2,2,2-trifluoroethyl)amino]methyl]oxan-3-yl]methyl]cyclopropanamine?
The InChIKey is BTSCQYMXRCDZMR-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H27F3N2O/c1-2-7-20(11-15(16,17)18)10-14(6-3-8-21-12-14)9-19-13-4-5-13/h13,19H,2-12H2,1H3.
What are the key properties of N-[[3-[[propyl(2,2,2-trifluoroethyl)amino]methyl]oxan-3-yl]methyl]cyclopropanamine?
N-[[3-[[propyl(2,2,2-trifluoroethyl)amino]methyl]oxan-3-yl]methyl]cyclopropanamine has a molecular weight of 308.39 g/mol, XLogP of 2.81, 8 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-[[3-[[propyl(2,2,2-trifluoroethyl)amino]methyl]oxan-3-yl]methyl]cyclopropanamine is sourced from PubChem (CID 63740316), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).