About N-(oxan-3-ylmethyl)-2-(1,3-thiazol-2-yl)ethanamine
N-(oxan-3-ylmethyl)-2-(1,3-thiazol-2-yl)ethanamine (PubChem CID 63740755) has the molecular formula C11H18N2OS
and a molecular weight of 226.34 g/mol. Its IUPAC name is N-(oxan-3-ylmethyl)-2-(1,3-thiazol-2-yl)ethanamine.
Molecular Properties
| Compound Name | N-(oxan-3-ylmethyl)-2-(1,3-thiazol-2-yl)ethanamine |
| PubChem CID | 63740755 |
| Molecular Formula | C11H18N2OS |
| Molecular Weight | 226.34 g/mol |
| Exact Mass | 226.11 |
| IUPAC Name | N-(oxan-3-ylmethyl)-2-(1,3-thiazol-2-yl)ethanamine |
| SMILES | c1csc(CCNCC2CCCOC2)n1 |
| InChI | InChI=1S/C11H18N2OS/c1-2-10(9-14-6-1)8-12-4-3-11-13-5-7-15-11/h5,7,10,12H,1-4,6,8-9H2 |
| InChIKey | ZGXCWVSXFCSXMY-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 226.34 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze N-(oxan-3-ylmethyl)-2-(1,3-thiazol-2-yl)ethanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(oxan-3-ylmethyl)-2-(1,3-thiazol-2-yl)ethanamine?
The IUPAC name of N-(oxan-3-ylmethyl)-2-(1,3-thiazol-2-yl)ethanamine (CID 63740755) is N-(oxan-3-ylmethyl)-2-(1,3-thiazol-2-yl)ethanamine.
What is the SMILES notation for N-(oxan-3-ylmethyl)-2-(1,3-thiazol-2-yl)ethanamine?
The canonical SMILES for N-(oxan-3-ylmethyl)-2-(1,3-thiazol-2-yl)ethanamine is c1csc(CCNCC2CCCOC2)n1.
What is the InChIKey of N-(oxan-3-ylmethyl)-2-(1,3-thiazol-2-yl)ethanamine?
The InChIKey is ZGXCWVSXFCSXMY-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18N2OS/c1-2-10(9-14-6-1)8-12-4-3-11-13-5-7-15-11/h5,7,10,12H,1-4,6,8-9H2.
What are the key properties of N-(oxan-3-ylmethyl)-2-(1,3-thiazol-2-yl)ethanamine?
N-(oxan-3-ylmethyl)-2-(1,3-thiazol-2-yl)ethanamine has a molecular weight of 226.34 g/mol, XLogP of 1.70, 5 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-(oxan-3-ylmethyl)-2-(1,3-thiazol-2-yl)ethanamine is sourced from PubChem (CID 63740755), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).