C16H27NO2 — CID 63740796
3-(3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-ylmethyl)oxane-3-carbaldehyde (PubChem CID 63740796) has the molecular formula C16H27NO2 and a molecular weight of 265.40 g/mol. Its IUPAC name is 3-(3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-ylmethyl)oxane-3-carbaldehyde.
| Compound Name | 3-(3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-ylmethyl)oxane-3-carbaldehyde |
|---|---|
| PubChem CID | 63740796 |
| Molecular Formula | C16H27NO2 |
| Molecular Weight | 265.40 g/mol |
| Exact Mass | 265.20 |
| IUPAC Name | 3-(3,4,4a,5,6,7,8,8a-octahydro-1H-isoquinolin-2-ylmethyl)oxane-3-carbaldehyde |
| SMILES | O=CC1(CN2CCC3CCCCC3C2)CCCOC1 |
| InChI | InChI=1S/C16H27NO2/c18-12-16(7-3-9-19-13-16)11-17-8-6-14-4-1-2-5-15(14)10-17/h12,14-15H,1-11,13H2 |
| InChIKey | VDNVOAFLTQRKPM-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.40 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|