C18H23N3O — CID 6374088
1-[(Z)-[(2E)-3,7-dimethylocta-2,6-dienylidene]amino]-4,6-dimethyl-2-oxopyridine-3-carbonitrile (PubChem CID 6374088) has the molecular formula C18H23N3O and a molecular weight of 297.40 g/mol. Its IUPAC name is 1-[(Z)-[(2E)-3,7-dimethylocta-2,6-dienylidene]amino]-4,6-dimethyl-2-oxopyridine-3-carbonitrile.
| Compound Name | 1-[(Z)-[(2E)-3,7-dimethylocta-2,6-dienylidene]amino]-4,6-dimethyl-2-oxopyridine-3-carbonitrile |
|---|---|
| PubChem CID | 6374088 |
| Molecular Formula | C18H23N3O |
| Molecular Weight | 297.40 g/mol |
| Exact Mass | 297.18 |
| IUPAC Name | 1-[(Z)-[(2E)-3,7-dimethylocta-2,6-dienylidene]amino]-4,6-dimethyl-2-oxopyridine-3-carbonitrile |
| SMILES | CC(C)=CCC/C(C)=C/C=N\n1c(C)cc(C)c(C#N)c1=O |
| InChI | InChI=1S/C18H23N3O/c1-13(2)7-6-8-14(3)9-10-20-21-16(5)11-15(4)17(12-19)18(21)22/h7,9-11H,6,8H2,1-5H3/b14-9+,20-10- |
| InChIKey | YJYWOHJALRTAEQ-SOCVPIHSSA-N |
| XLogP | 3.86 |
| TPSA | 58.15 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 297.40 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|