About (2Z)-2-imidazo[2,1-b][1,3]thiazol-6-yl-2-methoxyiminoacetic acid
(2Z)-2-imidazo[2,1-b][1,3]thiazol-6-yl-2-methoxyiminoacetic acid (PubChem CID 6374361) has the molecular formula C8H7N3O3S
and a molecular weight of 225.23 g/mol. Its IUPAC name is (2Z)-2-imidazo[2,1-b][1,3]thiazol-6-yl-2-methoxyiminoacetic acid.
Molecular Properties
| Compound Name | (2Z)-2-imidazo[2,1-b][1,3]thiazol-6-yl-2-methoxyiminoacetic acid |
| PubChem CID | 6374361 |
| Molecular Formula | C8H7N3O3S |
| Molecular Weight | 225.23 g/mol |
| Exact Mass | 225.02 |
| IUPAC Name | (2Z)-2-imidazo[2,1-b][1,3]thiazol-6-yl-2-methoxyiminoacetic acid |
| SMILES | CO/N=C(\C(=O)O)c1cn2ccsc2n1 |
| InChI | InChI=1S/C8H7N3O3S/c1-14-10-6(7(12)13)5-4-11-2-3-15-8(11)9-5/h2-4H,1H3,(H,12,13)/b10-6- |
| InChIKey | FBSRQGPEZQJHDL-POHAHGRESA-N |
| XLogP | 0.83 |
| TPSA | 76.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 225.23 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (2Z)-2-imidazo[2,1-b][1,3]thiazol-6-yl-2-methoxyiminoacetic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2Z)-2-imidazo[2,1-b][1,3]thiazol-6-yl-2-methoxyiminoacetic acid?
The IUPAC name of (2Z)-2-imidazo[2,1-b][1,3]thiazol-6-yl-2-methoxyiminoacetic acid (CID 6374361) is (2Z)-2-imidazo[2,1-b][1,3]thiazol-6-yl-2-methoxyiminoacetic acid.
What is the SMILES notation for (2Z)-2-imidazo[2,1-b][1,3]thiazol-6-yl-2-methoxyiminoacetic acid?
The canonical SMILES for (2Z)-2-imidazo[2,1-b][1,3]thiazol-6-yl-2-methoxyiminoacetic acid is CO/N=C(\C(=O)O)c1cn2ccsc2n1.
What is the InChIKey of (2Z)-2-imidazo[2,1-b][1,3]thiazol-6-yl-2-methoxyiminoacetic acid?
The InChIKey is FBSRQGPEZQJHDL-POHAHGRESA-N. The full InChI is InChI=1S/C8H7N3O3S/c1-14-10-6(7(12)13)5-4-11-2-3-15-8(11)9-5/h2-4H,1H3,(H,12,13)/b10-6-.
What are the key properties of (2Z)-2-imidazo[2,1-b][1,3]thiazol-6-yl-2-methoxyiminoacetic acid?
(2Z)-2-imidazo[2,1-b][1,3]thiazol-6-yl-2-methoxyiminoacetic acid has a molecular weight of 225.23 g/mol, XLogP of 0.83, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for (2Z)-2-imidazo[2,1-b][1,3]thiazol-6-yl-2-methoxyiminoacetic acid is sourced from PubChem (CID 6374361), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).