C23H34O5 — CID 637442
methyl (E,5R)-5-[(1S,2R,4aR,8aS)-1,2,4a,5-tetramethyl-7-oxo-3,4,8,8a-tetrahydro-2H-naphthalen-1-yl]-5-acetyloxy-3-methylpent-2-enoate (PubChem CID 637442) has the molecular formula C23H34O5 and a molecular weight of 390.52 g/mol. Its IUPAC name is methyl (E,5R)-5-[(1S,2R,4aR,8aS)-1,2,4a,5-tetramethyl-7-oxo-3,4,8,8a-tetrahydro-2H-naphthalen-1-yl]-5-acetyloxy-3-methylpent-2-enoate.
| Compound Name | methyl (E,5R)-5-[(1S,2R,4aR,8aS)-1,2,4a,5-tetramethyl-7-oxo-3,4,8,8a-tetrahydro-2H-naphthalen-1-yl]-5-acetyloxy-3-methylpent-2-enoate |
|---|---|
| PubChem CID | 637442 |
| Molecular Formula | C23H34O5 |
| Molecular Weight | 390.52 g/mol |
| Exact Mass | 390.24 |
| IUPAC Name | methyl (E,5R)-5-[(1S,2R,4aR,8aS)-1,2,4a,5-tetramethyl-7-oxo-3,4,8,8a-tetrahydro-2H-naphthalen-1-yl]-5-acetyloxy-3-methylpent-2-enoate |
| SMILES | COC(=O)/C=C(\C)C[C@@H](OC(C)=O)[C@@]1(C)[C@H](C)CC[C@@]2(C)C(C)=CC(=O)C[C@H]12 |
| InChI | InChI=1S/C23H34O5/c1-14(11-21(26)27-7)10-20(28-17(4)24)23(6)15(2)8-9-22(5)16(3)12-18(25)13-19(22)23/h11-12,15,19-20H,8-10,13H2,1-7H3/b14-11+/t15-,19+,20-,22+,23+/m1/s1 |
| InChIKey | DFFCAAPJUPLECN-XOHWVXQESA-N |
| XLogP | 4.41 |
| TPSA | 69.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.52 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|