About [6,7-dimethoxy-3-methyl-2-(trifluoromethyl)quinolin-4-yl]hydrazine
[6,7-dimethoxy-3-methyl-2-(trifluoromethyl)quinolin-4-yl]hydrazine (PubChem CID 63744262) has the molecular formula C13H14F3N3O2
and a molecular weight of 301.27 g/mol. Its IUPAC name is [6,7-dimethoxy-3-methyl-2-(trifluoromethyl)quinolin-4-yl]hydrazine.
Molecular Properties
| Compound Name | [6,7-dimethoxy-3-methyl-2-(trifluoromethyl)quinolin-4-yl]hydrazine |
| PubChem CID | 63744262 |
| Molecular Formula | C13H14F3N3O2 |
| Molecular Weight | 301.27 g/mol |
| Exact Mass | 301.10 |
| IUPAC Name | [6,7-dimethoxy-3-methyl-2-(trifluoromethyl)quinolin-4-yl]hydrazine |
| SMILES | COc1cc2nc(C(F)(F)F)c(C)c(NN)c2cc1OC |
| InChI | InChI=1S/C13H14F3N3O2/c1-6-11(19-17)7-4-9(20-2)10(21-3)5-8(7)18-12(6)13(14,15)16/h4-5H,17H2,1-3H3,(H,18,19) |
| InChIKey | RCYRYWVNDGZFSG-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 69.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 301.27 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze [6,7-dimethoxy-3-methyl-2-(trifluoromethyl)quinolin-4-yl]hydrazine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [6,7-dimethoxy-3-methyl-2-(trifluoromethyl)quinolin-4-yl]hydrazine?
The IUPAC name of [6,7-dimethoxy-3-methyl-2-(trifluoromethyl)quinolin-4-yl]hydrazine (CID 63744262) is [6,7-dimethoxy-3-methyl-2-(trifluoromethyl)quinolin-4-yl]hydrazine.
What is the SMILES notation for [6,7-dimethoxy-3-methyl-2-(trifluoromethyl)quinolin-4-yl]hydrazine?
The canonical SMILES for [6,7-dimethoxy-3-methyl-2-(trifluoromethyl)quinolin-4-yl]hydrazine is COc1cc2nc(C(F)(F)F)c(C)c(NN)c2cc1OC.
What is the InChIKey of [6,7-dimethoxy-3-methyl-2-(trifluoromethyl)quinolin-4-yl]hydrazine?
The InChIKey is RCYRYWVNDGZFSG-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14F3N3O2/c1-6-11(19-17)7-4-9(20-2)10(21-3)5-8(7)18-12(6)13(14,15)16/h4-5H,17H2,1-3H3,(H,18,19).
What are the key properties of [6,7-dimethoxy-3-methyl-2-(trifluoromethyl)quinolin-4-yl]hydrazine?
[6,7-dimethoxy-3-methyl-2-(trifluoromethyl)quinolin-4-yl]hydrazine has a molecular weight of 301.27 g/mol, XLogP of 2.86, 3 rotatable bonds, 2 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [6,7-dimethoxy-3-methyl-2-(trifluoromethyl)quinolin-4-yl]hydrazine is sourced from PubChem (CID 63744262), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).