About 7-fluoro-3,8-dimethyl-N-propyl-2-(trifluoromethyl)quinolin-4-amine
7-fluoro-3,8-dimethyl-N-propyl-2-(trifluoromethyl)quinolin-4-amine (PubChem CID 63744759) has the molecular formula C15H16F4N2
and a molecular weight of 300.30 g/mol. Its IUPAC name is 7-fluoro-3,8-dimethyl-N-propyl-2-(trifluoromethyl)quinolin-4-amine.
Molecular Properties
| Compound Name | 7-fluoro-3,8-dimethyl-N-propyl-2-(trifluoromethyl)quinolin-4-amine |
| PubChem CID | 63744759 |
| Molecular Formula | C15H16F4N2 |
| Molecular Weight | 300.30 g/mol |
| Exact Mass | 300.12 |
| IUPAC Name | 7-fluoro-3,8-dimethyl-N-propyl-2-(trifluoromethyl)quinolin-4-amine |
| SMILES | CCCNc1c(C)c(C(F)(F)F)nc2c(C)c(F)ccc12 |
| InChI | InChI=1S/C15H16F4N2/c1-4-7-20-12-9(3)14(15(17,18)19)21-13-8(2)11(16)6-5-10(12)13/h5-6H,4,7H2,1-3H3,(H,20,21) |
| InChIKey | IPDTVPLOSXSAFU-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 24.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 300.30 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 7-fluoro-3,8-dimethyl-N-propyl-2-(trifluoromethyl)quinolin-4-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 7-fluoro-3,8-dimethyl-N-propyl-2-(trifluoromethyl)quinolin-4-amine?
The IUPAC name of 7-fluoro-3,8-dimethyl-N-propyl-2-(trifluoromethyl)quinolin-4-amine (CID 63744759) is 7-fluoro-3,8-dimethyl-N-propyl-2-(trifluoromethyl)quinolin-4-amine.
What is the SMILES notation for 7-fluoro-3,8-dimethyl-N-propyl-2-(trifluoromethyl)quinolin-4-amine?
The canonical SMILES for 7-fluoro-3,8-dimethyl-N-propyl-2-(trifluoromethyl)quinolin-4-amine is CCCNc1c(C)c(C(F)(F)F)nc2c(C)c(F)ccc12.
What is the InChIKey of 7-fluoro-3,8-dimethyl-N-propyl-2-(trifluoromethyl)quinolin-4-amine?
The InChIKey is IPDTVPLOSXSAFU-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H16F4N2/c1-4-7-20-12-9(3)14(15(17,18)19)21-13-8(2)11(16)6-5-10(12)13/h5-6H,4,7H2,1-3H3,(H,20,21).
What are the key properties of 7-fluoro-3,8-dimethyl-N-propyl-2-(trifluoromethyl)quinolin-4-amine?
7-fluoro-3,8-dimethyl-N-propyl-2-(trifluoromethyl)quinolin-4-amine has a molecular weight of 300.30 g/mol, XLogP of 4.83, 3 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 7-fluoro-3,8-dimethyl-N-propyl-2-(trifluoromethyl)quinolin-4-amine is sourced from PubChem (CID 63744759), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).