C12H17N3O — CID 63744887
N-amino-N'-propan-2-yl-1,3-dihydro-2-benzofuran-5-carboximidamide (PubChem CID 63744887) has the molecular formula C12H17N3O and a molecular weight of 219.29 g/mol. Its IUPAC name is N-amino-N'-propan-2-yl-1,3-dihydro-2-benzofuran-5-carboximidamide.
| Compound Name | N-amino-N'-propan-2-yl-1,3-dihydro-2-benzofuran-5-carboximidamide |
|---|---|
| PubChem CID | 63744887 |
| Molecular Formula | C12H17N3O |
| Molecular Weight | 219.29 g/mol |
| Exact Mass | 219.14 |
| IUPAC Name | N-amino-N'-propan-2-yl-1,3-dihydro-2-benzofuran-5-carboximidamide |
| SMILES | CC(C)/N=C(\NN)c1ccc2c(c1)COC2 |
| InChI | InChI=1S/C12H17N3O/c1-8(2)14-12(15-13)9-3-4-10-6-16-7-11(10)5-9/h3-5,8H,6-7,13H2,1-2H3,(H,14,15) |
| InChIKey | QAVKQVLYDNZLKM-UHFFFAOYSA-N |
| XLogP | 1.34 |
| TPSA | 59.64 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 219.29 |
| LogP ≤ 5 | 1.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'hydrazine', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|