C12H14ClN5O2S — CID 63745128
[5-[(2-chloro-6-nitrophenyl)methylsulfanyl]-4-ethyl-1,2,4-triazol-3-yl]methanamine (PubChem CID 63745128) has the molecular formula C12H14ClN5O2S and a molecular weight of 327.80 g/mol. Its IUPAC name is [5-[(2-chloro-6-nitrophenyl)methylsulfanyl]-4-ethyl-1,2,4-triazol-3-yl]methanamine.
| Compound Name | [5-[(2-chloro-6-nitrophenyl)methylsulfanyl]-4-ethyl-1,2,4-triazol-3-yl]methanamine |
|---|---|
| PubChem CID | 63745128 |
| Molecular Formula | C12H14ClN5O2S |
| Molecular Weight | 327.80 g/mol |
| Exact Mass | 327.06 |
| IUPAC Name | [5-[(2-chloro-6-nitrophenyl)methylsulfanyl]-4-ethyl-1,2,4-triazol-3-yl]methanamine |
| SMILES | CCn1c(CN)nnc1SCc1c(Cl)cccc1[N+](=O)[O-] |
| InChI | InChI=1S/C12H14ClN5O2S/c1-2-17-11(6-14)15-16-12(17)21-7-8-9(13)4-3-5-10(8)18(19)20/h3-5H,2,6-7,14H2,1H3 |
| InChIKey | UJSBQPSKEFVHMI-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 99.87 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 327.80 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|