C13H19ClN2O2 — CID 63745481
1-(2-chloro-6-nitrophenyl)-N,2-dimethylpentan-3-amine (PubChem CID 63745481) has the molecular formula C13H19ClN2O2 and a molecular weight of 270.76 g/mol. Its IUPAC name is 1-(2-chloro-6-nitrophenyl)-N,2-dimethylpentan-3-amine.
| Compound Name | 1-(2-chloro-6-nitrophenyl)-N,2-dimethylpentan-3-amine |
|---|---|
| PubChem CID | 63745481 |
| Molecular Formula | C13H19ClN2O2 |
| Molecular Weight | 270.76 g/mol |
| Exact Mass | 270.11 |
| IUPAC Name | 1-(2-chloro-6-nitrophenyl)-N,2-dimethylpentan-3-amine |
| SMILES | CCC(NC)C(C)Cc1c(Cl)cccc1[N+](=O)[O-] |
| InChI | InChI=1S/C13H19ClN2O2/c1-4-12(15-3)9(2)8-10-11(14)6-5-7-13(10)16(17)18/h5-7,9,12,15H,4,8H2,1-3H3 |
| InChIKey | YFBRMQFYUXLGPU-UHFFFAOYSA-N |
| XLogP | 3.42 |
| TPSA | 55.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.76 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|