About (E)-8-oxooctadec-9-enoic acid
(E)-8-oxooctadec-9-enoic acid (PubChem CID 637456) has the molecular formula C18H32O3
and a molecular weight of 296.45 g/mol. Its IUPAC name is (E)-8-oxooctadec-9-enoic acid.
Molecular Properties
| Compound Name | (E)-8-oxooctadec-9-enoic acid |
| PubChem CID | 637456 |
| Molecular Formula | C18H32O3 |
| Molecular Weight | 296.45 g/mol |
| Exact Mass | 296.24 |
| IUPAC Name | (E)-8-oxooctadec-9-enoic acid |
| SMILES | CCCCCCCC/C=C/C(=O)CCCCCCC(=O)O |
| InChI | InChI=1S/C18H32O3/c1-2-3-4-5-6-7-8-11-14-17(19)15-12-9-10-13-16-18(20)21/h11,14H,2-10,12-13,15-16H2,1H3,(H,20,21)/b14-11+ |
| InChIKey | PHIXKQDGLSTYQU-SDNWHVSQSA-N |
| XLogP | 5.29 |
| TPSA | 54.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 21 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 296.45 |
| LogP ≤ 5 | 5.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze (E)-8-oxooctadec-9-enoic acid with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (E)-8-oxooctadec-9-enoic acid?
The IUPAC name of (E)-8-oxooctadec-9-enoic acid (CID 637456) is (E)-8-oxooctadec-9-enoic acid.
What is the SMILES notation for (E)-8-oxooctadec-9-enoic acid?
The canonical SMILES for (E)-8-oxooctadec-9-enoic acid is CCCCCCCC/C=C/C(=O)CCCCCCC(=O)O.
What is the InChIKey of (E)-8-oxooctadec-9-enoic acid?
The InChIKey is PHIXKQDGLSTYQU-SDNWHVSQSA-N. The full InChI is InChI=1S/C18H32O3/c1-2-3-4-5-6-7-8-11-14-17(19)15-12-9-10-13-16-18(20)21/h11,14H,2-10,12-13,15-16H2,1H3,(H,20,21)/b14-11+.
What are the key properties of (E)-8-oxooctadec-9-enoic acid?
(E)-8-oxooctadec-9-enoic acid has a molecular weight of 296.45 g/mol, XLogP of 5.29, 15 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (E)-8-oxooctadec-9-enoic acid is sourced from PubChem (CID 637456), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).