C17H14F3NO3S2 — CID 6374563
(2Z)-4,4,4-trifluoro-2-[[[methyl-(4-methylphenyl)-oxo-λ6-sulfanylidene]amino]methylidene]-1-thiophen-2-ylbutane-1,3-dione (PubChem CID 6374563) has the molecular formula C17H14F3NO3S2 and a molecular weight of 401.43 g/mol. Its IUPAC name is (2Z)-4,4,4-trifluoro-2-[[[methyl-(4-methylphenyl)-oxo-λ6-sulfanylidene]amino]methylidene]-1-thiophen-2-ylbutane-1,3-dione.
| Compound Name | (2Z)-4,4,4-trifluoro-2-[[[methyl-(4-methylphenyl)-oxo-λ6-sulfanylidene]amino]methylidene]-1-thiophen-2-ylbutane-1,3-dione |
|---|---|
| PubChem CID | 6374563 |
| Molecular Formula | C17H14F3NO3S2 |
| Molecular Weight | 401.43 g/mol |
| Exact Mass | 401.04 |
| IUPAC Name | (2Z)-4,4,4-trifluoro-2-[[[methyl-(4-methylphenyl)-oxo-λ6-sulfanylidene]amino]methylidene]-1-thiophen-2-ylbutane-1,3-dione |
| SMILES | Cc1ccc(S(C)(=O)=N/C=C(\C(=O)c2cccs2)C(=O)C(F)(F)F)cc1 |
| InChI | InChI=1S/C17H14F3NO3S2/c1-11-5-7-12(8-6-11)26(2,24)21-10-13(16(23)17(18,19)20)15(22)14-4-3-9-25-14/h3-10H,1-2H3/b13-10+ |
| InChIKey | NNWLDNMONHJSRI-JLHYYAGUSA-N |
| XLogP | 4.41 |
| TPSA | 63.57 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.43 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_4', 'substructure': 'N/A'} |
|---|