C15H17ClN2O3 — CID 63745804
N-[(2-chloro-6-nitrophenyl)methyl]-4-(furan-2-yl)butan-2-amine (PubChem CID 63745804) has the molecular formula C15H17ClN2O3 and a molecular weight of 308.76 g/mol. Its IUPAC name is N-[(2-chloro-6-nitrophenyl)methyl]-4-(furan-2-yl)butan-2-amine.
| Compound Name | N-[(2-chloro-6-nitrophenyl)methyl]-4-(furan-2-yl)butan-2-amine |
|---|---|
| PubChem CID | 63745804 |
| Molecular Formula | C15H17ClN2O3 |
| Molecular Weight | 308.76 g/mol |
| Exact Mass | 308.09 |
| IUPAC Name | N-[(2-chloro-6-nitrophenyl)methyl]-4-(furan-2-yl)butan-2-amine |
| SMILES | CC(CCc1ccco1)NCc1c(Cl)cccc1[N+](=O)[O-] |
| InChI | InChI=1S/C15H17ClN2O3/c1-11(7-8-12-4-3-9-21-12)17-10-13-14(16)5-2-6-15(13)18(19)20/h2-6,9,11,17H,7-8,10H2,1H3 |
| InChIKey | QESXSONXRCZQNR-UHFFFAOYSA-N |
| XLogP | 3.95 |
| TPSA | 68.31 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.76 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|