C25H34O4 — CID 637464
(2R,3R)-2-[(2R,4R,5S,7S,8E,10E)-5,7-dihydroxy-4-methyl-11-phenylundeca-8,10-dien-2-yl]-3-ethyl-2,3-dihydropyran-6-one (PubChem CID 637464) has the molecular formula C25H34O4 and a molecular weight of 398.54 g/mol. Its IUPAC name is (2R,3R)-2-[(2R,4R,5S,7S,8E,10E)-5,7-dihydroxy-4-methyl-11-phenylundeca-8,10-dien-2-yl]-3-ethyl-2,3-dihydropyran-6-one.
| Compound Name | (2R,3R)-2-[(2R,4R,5S,7S,8E,10E)-5,7-dihydroxy-4-methyl-11-phenylundeca-8,10-dien-2-yl]-3-ethyl-2,3-dihydropyran-6-one |
|---|---|
| PubChem CID | 637464 |
| Molecular Formula | C25H34O4 |
| Molecular Weight | 398.54 g/mol |
| Exact Mass | 398.25 |
| IUPAC Name | (2R,3R)-2-[(2R,4R,5S,7S,8E,10E)-5,7-dihydroxy-4-methyl-11-phenylundeca-8,10-dien-2-yl]-3-ethyl-2,3-dihydropyran-6-one |
| SMILES | CC[C@@H]1C=CC(=O)O[C@@H]1[C@H](C)C[C@@H](C)[C@@H](O)C[C@H](O)/C=C/C=C/c1ccccc1 |
| InChI | InChI=1S/C25H34O4/c1-4-21-14-15-24(28)29-25(21)19(3)16-18(2)23(27)17-22(26)13-9-8-12-20-10-6-5-7-11-20/h5-15,18-19,21-23,25-27H,4,16-17H2,1-3H3/b12-8+,13-9+/t18-,19-,21-,22-,23+,25-/m1/s1 |
| InChIKey | UEOXWGVEBWQAGO-CWOYBQAJSA-N |
| XLogP | 4.54 |
| TPSA | 66.76 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.54 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|