C12H23NO2 — CID 63747612
[3-[[cyclopropylmethyl(methyl)amino]methyl]oxan-3-yl]methanol (PubChem CID 63747612) has the molecular formula C12H23NO2 and a molecular weight of 213.32 g/mol. Its IUPAC name is [3-[[cyclopropylmethyl(methyl)amino]methyl]oxan-3-yl]methanol.
| Compound Name | [3-[[cyclopropylmethyl(methyl)amino]methyl]oxan-3-yl]methanol |
|---|---|
| PubChem CID | 63747612 |
| Molecular Formula | C12H23NO2 |
| Molecular Weight | 213.32 g/mol |
| Exact Mass | 213.17 |
| IUPAC Name | [3-[[cyclopropylmethyl(methyl)amino]methyl]oxan-3-yl]methanol |
| SMILES | CN(CC1CC1)CC1(CO)CCCOC1 |
| InChI | InChI=1S/C12H23NO2/c1-13(7-11-3-4-11)8-12(9-14)5-2-6-15-10-12/h11,14H,2-10H2,1H3 |
| InChIKey | HMTJOLNJQJIQBH-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 32.70 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.32 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |