C8H15N5O2 — CID 6374861
4-amino-N,N-diethyl-N'-methoxy-1,2,5-oxadiazole-3-carboximidamide (PubChem CID 6374861) has the molecular formula C8H15N5O2 and a molecular weight of 213.24 g/mol. Its IUPAC name is 4-amino-N,N-diethyl-N'-methoxy-1,2,5-oxadiazole-3-carboximidamide.
| Compound Name | 4-amino-N,N-diethyl-N'-methoxy-1,2,5-oxadiazole-3-carboximidamide |
|---|---|
| PubChem CID | 6374861 |
| Molecular Formula | C8H15N5O2 |
| Molecular Weight | 213.24 g/mol |
| Exact Mass | 213.12 |
| IUPAC Name | 4-amino-N,N-diethyl-N'-methoxy-1,2,5-oxadiazole-3-carboximidamide |
| SMILES | CCN(CC)/C(=N\OC)c1nonc1N |
| InChI | InChI=1S/C8H15N5O2/c1-4-13(5-2)8(12-14-3)6-7(9)11-15-10-6/h4-5H2,1-3H3,(H2,9,11)/b12-8- |
| InChIKey | BFLBSQLBYPDKJE-WQLSENKSSA-N |
| XLogP | 0.30 |
| TPSA | 89.77 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 213.24 |
| LogP ≤ 5 | 0.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|