1-[(3-methyl-1,2-oxazol-5-yl)methyl]indole-6-carboxylic acid

C14H12N2O3 — CID 63749669

IUPAC1-[(3-methyl-1,2-oxazol-5-yl)methyl]indole-6-carboxylic acid
SMILESCc1cc(Cn2ccc3ccc(C(=O)O)cc32)on1
InChIInChI=1S/C14H12N2O3/c1-9-6-12(19-15-9)8-16-5-4-10-2-3-11(14(17)18)7-13(10)16/h2-7H,8H2,1H3,(H,17,18)
InChIKeyFFZHCMUQJWRIFI-UHFFFAOYSA-N
MW256.26 g/mol
LogP2.68
Rot. Bonds3

About 1-[(3-methyl-1,2-oxazol-5-yl)methyl]indole-6-carboxylic acid

1-[(3-methyl-1,2-oxazol-5-yl)methyl]indole-6-carboxylic acid (PubChem CID 63749669) has the molecular formula C14H12N2O3 and a molecular weight of 256.26 g/mol. Its IUPAC name is 1-[(3-methyl-1,2-oxazol-5-yl)methyl]indole-6-carboxylic acid.

Molecular Properties

Compound Name1-[(3-methyl-1,2-oxazol-5-yl)methyl]indole-6-carboxylic acid
PubChem CID63749669
Molecular FormulaC14H12N2O3
Molecular Weight256.26 g/mol
Exact Mass256.08
IUPAC Name1-[(3-methyl-1,2-oxazol-5-yl)methyl]indole-6-carboxylic acid
SMILESCc1cc(Cn2ccc3ccc(C(=O)O)cc32)on1
InChIInChI=1S/C14H12N2O3/c1-9-6-12(19-15-9)8-16-5-4-10-2-3-11(14(17)18)7-13(10)16/h2-7H,8H2,1H3,(H,17,18)
InChIKeyFFZHCMUQJWRIFI-UHFFFAOYSA-N
XLogP2.68
TPSA68.26 Ų
H-Bond Donors1
H-Bond Acceptors4
Rotatable Bonds3
Heavy Atoms19
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500256.26
LogP ≤ 52.68
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 104

Analyze 1-[(3-methyl-1,2-oxazol-5-yl)methyl]indole-6-carboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 1-[(3-methyl-1,2-oxazol-5-yl)methyl]indole-6-carboxylic acid?
The IUPAC name of 1-[(3-methyl-1,2-oxazol-5-yl)methyl]indole-6-carboxylic acid (CID 63749669) is 1-[(3-methyl-1,2-oxazol-5-yl)methyl]indole-6-carboxylic acid.
What is the SMILES notation for 1-[(3-methyl-1,2-oxazol-5-yl)methyl]indole-6-carboxylic acid?
The canonical SMILES for 1-[(3-methyl-1,2-oxazol-5-yl)methyl]indole-6-carboxylic acid is Cc1cc(Cn2ccc3ccc(C(=O)O)cc32)on1.
What is the InChIKey of 1-[(3-methyl-1,2-oxazol-5-yl)methyl]indole-6-carboxylic acid?
The InChIKey is FFZHCMUQJWRIFI-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H12N2O3/c1-9-6-12(19-15-9)8-16-5-4-10-2-3-11(14(17)18)7-13(10)16/h2-7H,8H2,1H3,(H,17,18).
What are the key properties of 1-[(3-methyl-1,2-oxazol-5-yl)methyl]indole-6-carboxylic acid?
1-[(3-methyl-1,2-oxazol-5-yl)methyl]indole-6-carboxylic acid has a molecular weight of 256.26 g/mol, XLogP of 2.68, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 1-[(3-methyl-1,2-oxazol-5-yl)methyl]indole-6-carboxylic acid is sourced from PubChem (CID 63749669), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).