C14H13ClF2N2O — CID 63750079
1-N-(5-chloro-2-methoxyphenyl)-2-(difluoromethyl)benzene-1,4-diamine (PubChem CID 63750079) has the molecular formula C14H13ClF2N2O and a molecular weight of 298.72 g/mol. Its IUPAC name is 1-N-(5-chloro-2-methoxyphenyl)-2-(difluoromethyl)benzene-1,4-diamine.
| Compound Name | 1-N-(5-chloro-2-methoxyphenyl)-2-(difluoromethyl)benzene-1,4-diamine |
|---|---|
| PubChem CID | 63750079 |
| Molecular Formula | C14H13ClF2N2O |
| Molecular Weight | 298.72 g/mol |
| Exact Mass | 298.07 |
| IUPAC Name | 1-N-(5-chloro-2-methoxyphenyl)-2-(difluoromethyl)benzene-1,4-diamine |
| SMILES | COc1ccc(Cl)cc1Nc1ccc(N)cc1C(F)F |
| InChI | InChI=1S/C14H13ClF2N2O/c1-20-13-5-2-8(15)6-12(13)19-11-4-3-9(18)7-10(11)14(16)17/h2-7,14,19H,18H2,1H3 |
| InChIKey | ARCFADGURSASKZ-UHFFFAOYSA-N |
| XLogP | 4.61 |
| TPSA | 47.28 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.72 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|