C9H12 — CID 637502
1,6-dimethylcyclohepta-1,3,5-triene (PubChem CID 637502) has the molecular formula C9H12 and a molecular weight of 120.19 g/mol. Its IUPAC name is 1,6-dimethylcyclohepta-1,3,5-triene.
| Compound Name | 1,6-dimethylcyclohepta-1,3,5-triene |
|---|---|
| PubChem CID | 637502 |
| Molecular Formula | C9H12 |
| Molecular Weight | 120.19 g/mol |
| Exact Mass | 120.09 |
| IUPAC Name | 1,6-dimethylcyclohepta-1,3,5-triene |
| SMILES | CC1=CC=CC=C(C)C1 |
| InChI | InChI=1S/C9H12/c1-8-5-3-4-6-9(2)7-8/h3-6H,7H2,1-2H3 |
| InChIKey | ORFSRCLPKJGKOH-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 120.19 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |