About 5-cyclopentylsulfanyl-1,3-dimethylpyrazole-4-carboximidamide
5-cyclopentylsulfanyl-1,3-dimethylpyrazole-4-carboximidamide (PubChem CID 63750570) has the molecular formula C11H18N4S
and a molecular weight of 238.36 g/mol. Its IUPAC name is 5-cyclopentylsulfanyl-1,3-dimethylpyrazole-4-carboximidamide.
Molecular Properties
| Compound Name | 5-cyclopentylsulfanyl-1,3-dimethylpyrazole-4-carboximidamide |
| PubChem CID | 63750570 |
| Molecular Formula | C11H18N4S |
| Molecular Weight | 238.36 g/mol |
| Exact Mass | 238.13 |
| IUPAC Name | 5-cyclopentylsulfanyl-1,3-dimethylpyrazole-4-carboximidamide |
| SMILES | [H]/N=C(\N)c1c(C)nn(C)c1SC1CCCC1 |
| InChI | InChI=1S/C11H18N4S/c1-7-9(10(12)13)11(15(2)14-7)16-8-5-3-4-6-8/h8H,3-6H2,1-2H3,(H3,12,13) |
| InChIKey | POCPQPJEJWEPFX-UHFFFAOYSA-N |
| XLogP | 2.05 |
| TPSA | 67.69 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 238.36 |
| LogP ≤ 5 | 2.05 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|
Analyze 5-cyclopentylsulfanyl-1,3-dimethylpyrazole-4-carboximidamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-cyclopentylsulfanyl-1,3-dimethylpyrazole-4-carboximidamide?
The IUPAC name of 5-cyclopentylsulfanyl-1,3-dimethylpyrazole-4-carboximidamide (CID 63750570) is 5-cyclopentylsulfanyl-1,3-dimethylpyrazole-4-carboximidamide.
What is the SMILES notation for 5-cyclopentylsulfanyl-1,3-dimethylpyrazole-4-carboximidamide?
The canonical SMILES for 5-cyclopentylsulfanyl-1,3-dimethylpyrazole-4-carboximidamide is [H]/N=C(\N)c1c(C)nn(C)c1SC1CCCC1.
What is the InChIKey of 5-cyclopentylsulfanyl-1,3-dimethylpyrazole-4-carboximidamide?
The InChIKey is POCPQPJEJWEPFX-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H18N4S/c1-7-9(10(12)13)11(15(2)14-7)16-8-5-3-4-6-8/h8H,3-6H2,1-2H3,(H3,12,13).
What are the key properties of 5-cyclopentylsulfanyl-1,3-dimethylpyrazole-4-carboximidamide?
5-cyclopentylsulfanyl-1,3-dimethylpyrazole-4-carboximidamide has a molecular weight of 238.36 g/mol, XLogP of 2.05, 3 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-cyclopentylsulfanyl-1,3-dimethylpyrazole-4-carboximidamide is sourced from PubChem (CID 63750570), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).