C10H15N7S — CID 63750571
5-[(4,5-dimethyl-1,2,4-triazol-3-yl)sulfanyl]-1,3-dimethylpyrazole-4-carboximidamide (PubChem CID 63750571) has the molecular formula C10H15N7S and a molecular weight of 265.35 g/mol. Its IUPAC name is 5-[(4,5-dimethyl-1,2,4-triazol-3-yl)sulfanyl]-1,3-dimethylpyrazole-4-carboximidamide.
| Compound Name | 5-[(4,5-dimethyl-1,2,4-triazol-3-yl)sulfanyl]-1,3-dimethylpyrazole-4-carboximidamide |
|---|---|
| PubChem CID | 63750571 |
| Molecular Formula | C10H15N7S |
| Molecular Weight | 265.35 g/mol |
| Exact Mass | 265.11 |
| IUPAC Name | 5-[(4,5-dimethyl-1,2,4-triazol-3-yl)sulfanyl]-1,3-dimethylpyrazole-4-carboximidamide |
| SMILES | [H]/N=C(\N)c1c(C)nn(C)c1Sc1nnc(C)n1C |
| InChI | InChI=1S/C10H15N7S/c1-5-7(8(11)12)9(17(4)15-5)18-10-14-13-6(2)16(10)3/h1-4H3,(H3,11,12) |
| InChIKey | CMOBXHSZIFLTRU-UHFFFAOYSA-N |
| XLogP | 0.60 |
| TPSA | 98.40 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.35 |
| LogP ≤ 5 | 0.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|