C17H15N3O — CID 63750754
3-(3,5-dimethylphenyl)-1-pyridin-2-ylpyrazole-4-carbaldehyde (PubChem CID 63750754) has the molecular formula C17H15N3O and a molecular weight of 277.33 g/mol. Its IUPAC name is 3-(3,5-dimethylphenyl)-1-pyridin-2-ylpyrazole-4-carbaldehyde.
| Compound Name | 3-(3,5-dimethylphenyl)-1-pyridin-2-ylpyrazole-4-carbaldehyde |
|---|---|
| PubChem CID | 63750754 |
| Molecular Formula | C17H15N3O |
| Molecular Weight | 277.33 g/mol |
| Exact Mass | 277.12 |
| IUPAC Name | 3-(3,5-dimethylphenyl)-1-pyridin-2-ylpyrazole-4-carbaldehyde |
| SMILES | Cc1cc(C)cc(-c2nn(-c3ccccn3)cc2C=O)c1 |
| InChI | InChI=1S/C17H15N3O/c1-12-7-13(2)9-14(8-12)17-15(11-21)10-20(19-17)16-5-3-4-6-18-16/h3-11H,1-2H3 |
| InChIKey | BMTUBKFJGCAEIS-UHFFFAOYSA-N |
| XLogP | 3.36 |
| TPSA | 47.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.33 |
| LogP ≤ 5 | 3.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|