About (1-phenyltetrazol-5-yl) (1E)-N-anilino-2-oxo-2-phenylethanimidothioate
(1-phenyltetrazol-5-yl) (1E)-N-anilino-2-oxo-2-phenylethanimidothioate (PubChem CID 6375113) has the molecular formula C21H16N6OS
and a molecular weight of 400.47 g/mol. Its IUPAC name is (1-phenyltetrazol-5-yl) (1E)-N-anilino-2-oxo-2-phenylethanimidothioate.
Molecular Properties
| Compound Name | (1-phenyltetrazol-5-yl) (1E)-N-anilino-2-oxo-2-phenylethanimidothioate |
| PubChem CID | 6375113 |
| Molecular Formula | C21H16N6OS |
| Molecular Weight | 400.47 g/mol |
| Exact Mass | 400.11 |
| IUPAC Name | (1-phenyltetrazol-5-yl) (1E)-N-anilino-2-oxo-2-phenylethanimidothioate |
| SMILES | O=C(/C(=N\Nc1ccccc1)Sc1nnnn1-c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C21H16N6OS/c28-19(16-10-4-1-5-11-16)20(23-22-17-12-6-2-7-13-17)29-21-24-25-26-27(21)18-14-8-3-9-15-18/h1-15,22H/b23-20+ |
| InChIKey | SVJGPVYWSQHLHX-BSYVCWPDSA-N |
| XLogP | 4.06 |
| TPSA | 85.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 400.47 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze (1-phenyltetrazol-5-yl) (1E)-N-anilino-2-oxo-2-phenylethanimidothioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (1-phenyltetrazol-5-yl) (1E)-N-anilino-2-oxo-2-phenylethanimidothioate?
The IUPAC name of (1-phenyltetrazol-5-yl) (1E)-N-anilino-2-oxo-2-phenylethanimidothioate (CID 6375113) is (1-phenyltetrazol-5-yl) (1E)-N-anilino-2-oxo-2-phenylethanimidothioate.
What is the SMILES notation for (1-phenyltetrazol-5-yl) (1E)-N-anilino-2-oxo-2-phenylethanimidothioate?
The canonical SMILES for (1-phenyltetrazol-5-yl) (1E)-N-anilino-2-oxo-2-phenylethanimidothioate is O=C(/C(=N\Nc1ccccc1)Sc1nnnn1-c1ccccc1)c1ccccc1.
What is the InChIKey of (1-phenyltetrazol-5-yl) (1E)-N-anilino-2-oxo-2-phenylethanimidothioate?
The InChIKey is SVJGPVYWSQHLHX-BSYVCWPDSA-N. The full InChI is InChI=1S/C21H16N6OS/c28-19(16-10-4-1-5-11-16)20(23-22-17-12-6-2-7-13-17)29-21-24-25-26-27(21)18-14-8-3-9-15-18/h1-15,22H/b23-20+.
What are the key properties of (1-phenyltetrazol-5-yl) (1E)-N-anilino-2-oxo-2-phenylethanimidothioate?
(1-phenyltetrazol-5-yl) (1E)-N-anilino-2-oxo-2-phenylethanimidothioate has a molecular weight of 400.47 g/mol, XLogP of 4.06, 6 rotatable bonds, 1 hydrogen bond donors, and 8 hydrogen bond acceptors.
Where does this data come from?
All data for (1-phenyltetrazol-5-yl) (1E)-N-anilino-2-oxo-2-phenylethanimidothioate is sourced from PubChem (CID 6375113), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).