C8H11F3N4O — CID 63751212
1,3-dimethyl-5-(2,2,2-trifluoroethoxy)pyrazole-4-carboximidamide (PubChem CID 63751212) has the molecular formula C8H11F3N4O and a molecular weight of 236.20 g/mol. Its IUPAC name is 1,3-dimethyl-5-(2,2,2-trifluoroethoxy)pyrazole-4-carboximidamide.
| Compound Name | 1,3-dimethyl-5-(2,2,2-trifluoroethoxy)pyrazole-4-carboximidamide |
|---|---|
| PubChem CID | 63751212 |
| Molecular Formula | C8H11F3N4O |
| Molecular Weight | 236.20 g/mol |
| Exact Mass | 236.09 |
| IUPAC Name | 1,3-dimethyl-5-(2,2,2-trifluoroethoxy)pyrazole-4-carboximidamide |
| SMILES | [H]/N=C(\N)c1c(C)nn(C)c1OCC(F)(F)F |
| InChI | InChI=1S/C8H11F3N4O/c1-4-5(6(12)13)7(15(2)14-4)16-3-8(9,10)11/h3H2,1-2H3,(H3,12,13) |
| InChIKey | LZZMOCRHMMYKCS-UHFFFAOYSA-N |
| XLogP | 0.95 |
| TPSA | 76.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.20 |
| LogP ≤ 5 | 0.95 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|