C12H19F3N6 — CID 63751705
1,3-dimethyl-5-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]pyrazole-4-carboximidamide (PubChem CID 63751705) has the molecular formula C12H19F3N6 and a molecular weight of 304.32 g/mol. Its IUPAC name is 1,3-dimethyl-5-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]pyrazole-4-carboximidamide.
| Compound Name | 1,3-dimethyl-5-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]pyrazole-4-carboximidamide |
|---|---|
| PubChem CID | 63751705 |
| Molecular Formula | C12H19F3N6 |
| Molecular Weight | 304.32 g/mol |
| Exact Mass | 304.16 |
| IUPAC Name | 1,3-dimethyl-5-[4-(2,2,2-trifluoroethyl)piperazin-1-yl]pyrazole-4-carboximidamide |
| SMILES | [H]/N=C(\N)c1c(C)nn(C)c1N1CCN(CC(F)(F)F)CC1 |
| InChI | InChI=1S/C12H19F3N6/c1-8-9(10(16)17)11(19(2)18-8)21-5-3-20(4-6-21)7-12(13,14)15/h3-7H2,1-2H3,(H3,16,17) |
| InChIKey | WLQBPXGFACVQDN-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 74.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.32 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|