About 3-hydroxy-N,N-dimethylbenzamide
3-hydroxy-N,N-dimethylbenzamide (PubChem CID 637524) has the molecular formula C9H11NO2
and a molecular weight of 165.19 g/mol. Its IUPAC name is 3-hydroxy-N,N-dimethylbenzamide.
Molecular Properties
| Compound Name | 3-hydroxy-N,N-dimethylbenzamide |
| PubChem CID | 637524 |
| Molecular Formula | C9H11NO2 |
| Molecular Weight | 165.19 g/mol |
| Exact Mass | 165.08 |
| IUPAC Name | 3-hydroxy-N,N-dimethylbenzamide |
| SMILES | CN(C)C(=O)c1cccc(O)c1 |
| InChI | InChI=1S/C9H11NO2/c1-10(2)9(12)7-4-3-5-8(11)6-7/h3-6,11H,1-2H3 |
| InChIKey | TULKODADVOEVTR-UHFFFAOYSA-N |
| XLogP | 1.09 |
| TPSA | 40.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 165.19 |
| LogP ≤ 5 | 1.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 3-hydroxy-N,N-dimethylbenzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3-hydroxy-N,N-dimethylbenzamide?
The IUPAC name of 3-hydroxy-N,N-dimethylbenzamide (CID 637524) is 3-hydroxy-N,N-dimethylbenzamide.
What is the SMILES notation for 3-hydroxy-N,N-dimethylbenzamide?
The canonical SMILES for 3-hydroxy-N,N-dimethylbenzamide is CN(C)C(=O)c1cccc(O)c1.
What is the InChIKey of 3-hydroxy-N,N-dimethylbenzamide?
The InChIKey is TULKODADVOEVTR-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H11NO2/c1-10(2)9(12)7-4-3-5-8(11)6-7/h3-6,11H,1-2H3.
What are the key properties of 3-hydroxy-N,N-dimethylbenzamide?
3-hydroxy-N,N-dimethylbenzamide has a molecular weight of 165.19 g/mol, XLogP of 1.09, 1 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 3-hydroxy-N,N-dimethylbenzamide is sourced from PubChem (CID 637524), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).