About 5-cyclopentylsulfanyl-1,3-dimethylpyrazole-4-carbonitrile
5-cyclopentylsulfanyl-1,3-dimethylpyrazole-4-carbonitrile (PubChem CID 63753031) has the molecular formula C11H15N3S
and a molecular weight of 221.33 g/mol. Its IUPAC name is 5-cyclopentylsulfanyl-1,3-dimethylpyrazole-4-carbonitrile.
Molecular Properties
| Compound Name | 5-cyclopentylsulfanyl-1,3-dimethylpyrazole-4-carbonitrile |
| PubChem CID | 63753031 |
| Molecular Formula | C11H15N3S |
| Molecular Weight | 221.33 g/mol |
| Exact Mass | 221.10 |
| IUPAC Name | 5-cyclopentylsulfanyl-1,3-dimethylpyrazole-4-carbonitrile |
| SMILES | Cc1nn(C)c(SC2CCCC2)c1C#N |
| InChI | InChI=1S/C11H15N3S/c1-8-10(7-12)11(14(2)13-8)15-9-5-3-4-6-9/h9H,3-6H2,1-2H3 |
| InChIKey | IPFSVEXMKLYPKI-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 41.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 221.33 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-cyclopentylsulfanyl-1,3-dimethylpyrazole-4-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-cyclopentylsulfanyl-1,3-dimethylpyrazole-4-carbonitrile?
The IUPAC name of 5-cyclopentylsulfanyl-1,3-dimethylpyrazole-4-carbonitrile (CID 63753031) is 5-cyclopentylsulfanyl-1,3-dimethylpyrazole-4-carbonitrile.
What is the SMILES notation for 5-cyclopentylsulfanyl-1,3-dimethylpyrazole-4-carbonitrile?
The canonical SMILES for 5-cyclopentylsulfanyl-1,3-dimethylpyrazole-4-carbonitrile is Cc1nn(C)c(SC2CCCC2)c1C#N.
What is the InChIKey of 5-cyclopentylsulfanyl-1,3-dimethylpyrazole-4-carbonitrile?
The InChIKey is IPFSVEXMKLYPKI-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H15N3S/c1-8-10(7-12)11(14(2)13-8)15-9-5-3-4-6-9/h9H,3-6H2,1-2H3.
What are the key properties of 5-cyclopentylsulfanyl-1,3-dimethylpyrazole-4-carbonitrile?
5-cyclopentylsulfanyl-1,3-dimethylpyrazole-4-carbonitrile has a molecular weight of 221.33 g/mol, XLogP of 2.63, 2 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-cyclopentylsulfanyl-1,3-dimethylpyrazole-4-carbonitrile is sourced from PubChem (CID 63753031), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).