C14H13F3N2O — CID 63753318
1-(1-benzyl-3,5-dimethylpyrazol-4-yl)-2,2,2-trifluoroethanone (PubChem CID 63753318) has the molecular formula C14H13F3N2O and a molecular weight of 282.26 g/mol. Its IUPAC name is 1-(1-benzyl-3,5-dimethylpyrazol-4-yl)-2,2,2-trifluoroethanone.
| Compound Name | 1-(1-benzyl-3,5-dimethylpyrazol-4-yl)-2,2,2-trifluoroethanone |
|---|---|
| PubChem CID | 63753318 |
| Molecular Formula | C14H13F3N2O |
| Molecular Weight | 282.26 g/mol |
| Exact Mass | 282.10 |
| IUPAC Name | 1-(1-benzyl-3,5-dimethylpyrazol-4-yl)-2,2,2-trifluoroethanone |
| SMILES | Cc1nn(Cc2ccccc2)c(C)c1C(=O)C(F)(F)F |
| InChI | InChI=1S/C14H13F3N2O/c1-9-12(13(20)14(15,16)17)10(2)19(18-9)8-11-6-4-3-5-7-11/h3-7H,8H2,1-2H3 |
| InChIKey | YYDRORLIJMIAIL-UHFFFAOYSA-N |
| XLogP | 3.29 |
| TPSA | 34.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.26 |
| LogP ≤ 5 | 3.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |