About (2R,5R)-2,5-dimethoxy-2,5-dihydrofuran
(2R,5R)-2,5-dimethoxy-2,5-dihydrofuran (PubChem CID 637543) has the molecular formula C6H10O3
and a molecular weight of 130.14 g/mol. Its IUPAC name is (2R,5R)-2,5-dimethoxy-2,5-dihydrofuran.
Molecular Properties
| Compound Name | (2R,5R)-2,5-dimethoxy-2,5-dihydrofuran |
| PubChem CID | 637543 |
| Molecular Formula | C6H10O3 |
| Molecular Weight | 130.14 g/mol |
| Exact Mass | 130.06 |
| IUPAC Name | (2R,5R)-2,5-dimethoxy-2,5-dihydrofuran |
| SMILES | CO[C@H]1C=C[C@H](OC)O1 |
| InChI | InChI=1S/C6H10O3/c1-7-5-3-4-6(8-2)9-5/h3-6H,1-2H3/t5-,6-/m1/s1 |
| InChIKey | WXFWXFIWDGJRSC-PHDIDXHHSA-N |
| XLogP | 0.52 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 130.14 |
| LogP ≤ 5 | 0.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze (2R,5R)-2,5-dimethoxy-2,5-dihydrofuran with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R,5R)-2,5-dimethoxy-2,5-dihydrofuran?
The IUPAC name of (2R,5R)-2,5-dimethoxy-2,5-dihydrofuran (CID 637543) is (2R,5R)-2,5-dimethoxy-2,5-dihydrofuran.
What is the SMILES notation for (2R,5R)-2,5-dimethoxy-2,5-dihydrofuran?
The canonical SMILES for (2R,5R)-2,5-dimethoxy-2,5-dihydrofuran is CO[C@H]1C=C[C@H](OC)O1.
What is the InChIKey of (2R,5R)-2,5-dimethoxy-2,5-dihydrofuran?
The InChIKey is WXFWXFIWDGJRSC-PHDIDXHHSA-N. The full InChI is InChI=1S/C6H10O3/c1-7-5-3-4-6(8-2)9-5/h3-6H,1-2H3/t5-,6-/m1/s1.
What are the key properties of (2R,5R)-2,5-dimethoxy-2,5-dihydrofuran?
(2R,5R)-2,5-dimethoxy-2,5-dihydrofuran has a molecular weight of 130.14 g/mol, XLogP of 0.52, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for (2R,5R)-2,5-dimethoxy-2,5-dihydrofuran is sourced from PubChem (CID 637543), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).