(2E,6E)-2,6-dimethylocta-2,6-dienedioic acid

C10H14O4 — CID 6375438

IUPAC(2E,6E)-2,6-dimethylocta-2,6-dienedioic acid
SMILESC/C(=C\C(=O)O)CC/C=C(\C)C(=O)O
InChIInChI=1S/C10H14O4/c1-7(6-9(11)12)4-3-5-8(2)10(13)14/h5-6H,3-4H2,1-2H3,(H,11,12)(H,13,14)/b7-6+,8-5+
InChIKeyIUBQEOXMIZDLSO-ZCOYIIAOSA-N
MW198.22 g/mol
LogP1.83
Rot. Bonds5

About (2E,6E)-2,6-dimethylocta-2,6-dienedioic acid

(2E,6E)-2,6-dimethylocta-2,6-dienedioic acid (PubChem CID 6375438) has the molecular formula C10H14O4 and a molecular weight of 198.22 g/mol. Its IUPAC name is (2E,6E)-2,6-dimethylocta-2,6-dienedioic acid.

Molecular Properties

Compound Name(2E,6E)-2,6-dimethylocta-2,6-dienedioic acid
PubChem CID6375438
Molecular FormulaC10H14O4
Molecular Weight198.22 g/mol
Exact Mass198.09
IUPAC Name(2E,6E)-2,6-dimethylocta-2,6-dienedioic acid
SMILESC/C(=C\C(=O)O)CC/C=C(\C)C(=O)O
InChIInChI=1S/C10H14O4/c1-7(6-9(11)12)4-3-5-8(2)10(13)14/h5-6H,3-4H2,1-2H3,(H,11,12)(H,13,14)/b7-6+,8-5+
InChIKeyIUBQEOXMIZDLSO-ZCOYIIAOSA-N
XLogP1.83
TPSA74.60 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds5
Heavy Atoms14
Complexity—

Lipinski Rule of Five

Passes Rule of Five

RuleValue
MW ≤ 500198.22
LogP ≤ 51.83
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}

Analyze (2E,6E)-2,6-dimethylocta-2,6-dienedioic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of (2E,6E)-2,6-dimethylocta-2,6-dienedioic acid?
The IUPAC name of (2E,6E)-2,6-dimethylocta-2,6-dienedioic acid (CID 6375438) is (2E,6E)-2,6-dimethylocta-2,6-dienedioic acid.
What is the SMILES notation for (2E,6E)-2,6-dimethylocta-2,6-dienedioic acid?
The canonical SMILES for (2E,6E)-2,6-dimethylocta-2,6-dienedioic acid is C/C(=C\C(=O)O)CC/C=C(\C)C(=O)O.
What is the InChIKey of (2E,6E)-2,6-dimethylocta-2,6-dienedioic acid?
The InChIKey is IUBQEOXMIZDLSO-ZCOYIIAOSA-N. The full InChI is InChI=1S/C10H14O4/c1-7(6-9(11)12)4-3-5-8(2)10(13)14/h5-6H,3-4H2,1-2H3,(H,11,12)(H,13,14)/b7-6+,8-5+.
What are the key properties of (2E,6E)-2,6-dimethylocta-2,6-dienedioic acid?
(2E,6E)-2,6-dimethylocta-2,6-dienedioic acid has a molecular weight of 198.22 g/mol, XLogP of 1.83, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2E,6E)-2,6-dimethylocta-2,6-dienedioic acid is sourced from PubChem (CID 6375438), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).