About [1,3-dimethyl-5-(1,3-thiazol-2-ylsulfanyl)pyrazol-4-yl]methanamine
[1,3-dimethyl-5-(1,3-thiazol-2-ylsulfanyl)pyrazol-4-yl]methanamine (PubChem CID 63756336) has the molecular formula C9H12N4S2
and a molecular weight of 240.36 g/mol. Its IUPAC name is [1,3-dimethyl-5-(1,3-thiazol-2-ylsulfanyl)pyrazol-4-yl]methanamine.
Molecular Properties
| Compound Name | [1,3-dimethyl-5-(1,3-thiazol-2-ylsulfanyl)pyrazol-4-yl]methanamine |
| PubChem CID | 63756336 |
| Molecular Formula | C9H12N4S2 |
| Molecular Weight | 240.36 g/mol |
| Exact Mass | 240.05 |
| IUPAC Name | [1,3-dimethyl-5-(1,3-thiazol-2-ylsulfanyl)pyrazol-4-yl]methanamine |
| SMILES | Cc1nn(C)c(Sc2nccs2)c1CN |
| InChI | InChI=1S/C9H12N4S2/c1-6-7(5-10)8(13(2)12-6)15-9-11-3-4-14-9/h3-4H,5,10H2,1-2H3 |
| InChIKey | CHOVDEIALGYEFM-UHFFFAOYSA-N |
| XLogP | 1.79 |
| TPSA | 56.73 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 240.36 |
| LogP ≤ 5 | 1.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiazol_SC_A(3)', 'substructure': 'N/A'} |
|---|
Analyze [1,3-dimethyl-5-(1,3-thiazol-2-ylsulfanyl)pyrazol-4-yl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [1,3-dimethyl-5-(1,3-thiazol-2-ylsulfanyl)pyrazol-4-yl]methanamine?
The IUPAC name of [1,3-dimethyl-5-(1,3-thiazol-2-ylsulfanyl)pyrazol-4-yl]methanamine (CID 63756336) is [1,3-dimethyl-5-(1,3-thiazol-2-ylsulfanyl)pyrazol-4-yl]methanamine.
What is the SMILES notation for [1,3-dimethyl-5-(1,3-thiazol-2-ylsulfanyl)pyrazol-4-yl]methanamine?
The canonical SMILES for [1,3-dimethyl-5-(1,3-thiazol-2-ylsulfanyl)pyrazol-4-yl]methanamine is Cc1nn(C)c(Sc2nccs2)c1CN.
What is the InChIKey of [1,3-dimethyl-5-(1,3-thiazol-2-ylsulfanyl)pyrazol-4-yl]methanamine?
The InChIKey is CHOVDEIALGYEFM-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H12N4S2/c1-6-7(5-10)8(13(2)12-6)15-9-11-3-4-14-9/h3-4H,5,10H2,1-2H3.
What are the key properties of [1,3-dimethyl-5-(1,3-thiazol-2-ylsulfanyl)pyrazol-4-yl]methanamine?
[1,3-dimethyl-5-(1,3-thiazol-2-ylsulfanyl)pyrazol-4-yl]methanamine has a molecular weight of 240.36 g/mol, XLogP of 1.79, 3 rotatable bonds, 1 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for [1,3-dimethyl-5-(1,3-thiazol-2-ylsulfanyl)pyrazol-4-yl]methanamine is sourced from PubChem (CID 63756336), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).