About 5-(4-chloro-2,6-dimethylphenoxy)-1,3-dimethylpyrazole-4-carbothioamide
5-(4-chloro-2,6-dimethylphenoxy)-1,3-dimethylpyrazole-4-carbothioamide (PubChem CID 63757074) has the molecular formula C14H16ClN3OS
and a molecular weight of 309.82 g/mol. Its IUPAC name is 5-(4-chloro-2,6-dimethylphenoxy)-1,3-dimethylpyrazole-4-carbothioamide.
Molecular Properties
| Compound Name | 5-(4-chloro-2,6-dimethylphenoxy)-1,3-dimethylpyrazole-4-carbothioamide |
| PubChem CID | 63757074 |
| Molecular Formula | C14H16ClN3OS |
| Molecular Weight | 309.82 g/mol |
| Exact Mass | 309.07 |
| IUPAC Name | 5-(4-chloro-2,6-dimethylphenoxy)-1,3-dimethylpyrazole-4-carbothioamide |
| SMILES | Cc1cc(Cl)cc(C)c1Oc1c(C(N)=S)c(C)nn1C |
| InChI | InChI=1S/C14H16ClN3OS/c1-7-5-10(15)6-8(2)12(7)19-14-11(13(16)20)9(3)17-18(14)4/h5-6H,1-4H3,(H2,16,20) |
| InChIKey | JSSNUBAEUFEOMW-UHFFFAOYSA-N |
| XLogP | 3.43 |
| TPSA | 53.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 309.82 |
| LogP ≤ 5 | 3.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 5-(4-chloro-2,6-dimethylphenoxy)-1,3-dimethylpyrazole-4-carbothioamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(4-chloro-2,6-dimethylphenoxy)-1,3-dimethylpyrazole-4-carbothioamide?
The IUPAC name of 5-(4-chloro-2,6-dimethylphenoxy)-1,3-dimethylpyrazole-4-carbothioamide (CID 63757074) is 5-(4-chloro-2,6-dimethylphenoxy)-1,3-dimethylpyrazole-4-carbothioamide.
What is the SMILES notation for 5-(4-chloro-2,6-dimethylphenoxy)-1,3-dimethylpyrazole-4-carbothioamide?
The canonical SMILES for 5-(4-chloro-2,6-dimethylphenoxy)-1,3-dimethylpyrazole-4-carbothioamide is Cc1cc(Cl)cc(C)c1Oc1c(C(N)=S)c(C)nn1C.
What is the InChIKey of 5-(4-chloro-2,6-dimethylphenoxy)-1,3-dimethylpyrazole-4-carbothioamide?
The InChIKey is JSSNUBAEUFEOMW-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H16ClN3OS/c1-7-5-10(15)6-8(2)12(7)19-14-11(13(16)20)9(3)17-18(14)4/h5-6H,1-4H3,(H2,16,20).
What are the key properties of 5-(4-chloro-2,6-dimethylphenoxy)-1,3-dimethylpyrazole-4-carbothioamide?
5-(4-chloro-2,6-dimethylphenoxy)-1,3-dimethylpyrazole-4-carbothioamide has a molecular weight of 309.82 g/mol, XLogP of 3.43, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(4-chloro-2,6-dimethylphenoxy)-1,3-dimethylpyrazole-4-carbothioamide is sourced from PubChem (CID 63757074), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).