About 5-(ethylamino)-1,3-dimethylpyrazole-4-carbonitrile
5-(ethylamino)-1,3-dimethylpyrazole-4-carbonitrile (PubChem CID 63757322) has the molecular formula C8H12N4
and a molecular weight of 164.21 g/mol. Its IUPAC name is 5-(ethylamino)-1,3-dimethylpyrazole-4-carbonitrile.
Molecular Properties
| Compound Name | 5-(ethylamino)-1,3-dimethylpyrazole-4-carbonitrile |
| PubChem CID | 63757322 |
| Molecular Formula | C8H12N4 |
| Molecular Weight | 164.21 g/mol |
| Exact Mass | 164.11 |
| IUPAC Name | 5-(ethylamino)-1,3-dimethylpyrazole-4-carbonitrile |
| SMILES | CCNc1c(C#N)c(C)nn1C |
| InChI | InChI=1S/C8H12N4/c1-4-10-8-7(5-9)6(2)11-12(8)3/h10H,4H2,1-3H3 |
| InChIKey | IBMPOPNXISEJEL-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 53.64 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 164.21 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 5-(ethylamino)-1,3-dimethylpyrazole-4-carbonitrile with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(ethylamino)-1,3-dimethylpyrazole-4-carbonitrile?
The IUPAC name of 5-(ethylamino)-1,3-dimethylpyrazole-4-carbonitrile (CID 63757322) is 5-(ethylamino)-1,3-dimethylpyrazole-4-carbonitrile.
What is the SMILES notation for 5-(ethylamino)-1,3-dimethylpyrazole-4-carbonitrile?
The canonical SMILES for 5-(ethylamino)-1,3-dimethylpyrazole-4-carbonitrile is CCNc1c(C#N)c(C)nn1C.
What is the InChIKey of 5-(ethylamino)-1,3-dimethylpyrazole-4-carbonitrile?
The InChIKey is IBMPOPNXISEJEL-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H12N4/c1-4-10-8-7(5-9)6(2)11-12(8)3/h10H,4H2,1-3H3.
What are the key properties of 5-(ethylamino)-1,3-dimethylpyrazole-4-carbonitrile?
5-(ethylamino)-1,3-dimethylpyrazole-4-carbonitrile has a molecular weight of 164.21 g/mol, XLogP of 1.03, 2 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(ethylamino)-1,3-dimethylpyrazole-4-carbonitrile is sourced from PubChem (CID 63757322), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).