C14H10F3N3O — CID 63757477
3-(3-ethylimidazo[4,5-b]pyridin-2-yl)-2,5,6-trifluorophenol (PubChem CID 63757477) has the molecular formula C14H10F3N3O and a molecular weight of 293.25 g/mol. Its IUPAC name is 3-(3-ethylimidazo[4,5-b]pyridin-2-yl)-2,5,6-trifluorophenol.
| Compound Name | 3-(3-ethylimidazo[4,5-b]pyridin-2-yl)-2,5,6-trifluorophenol |
|---|---|
| PubChem CID | 63757477 |
| Molecular Formula | C14H10F3N3O |
| Molecular Weight | 293.25 g/mol |
| Exact Mass | 293.08 |
| IUPAC Name | 3-(3-ethylimidazo[4,5-b]pyridin-2-yl)-2,5,6-trifluorophenol |
| SMILES | CCn1c(-c2cc(F)c(F)c(O)c2F)nc2cccnc21 |
| InChI | InChI=1S/C14H10F3N3O/c1-2-20-13(19-9-4-3-5-18-14(9)20)7-6-8(15)11(17)12(21)10(7)16/h3-6,21H,2H2,1H3 |
| InChIKey | VOMYIVUTUIAIPR-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 50.94 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.25 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|