About diethyl (E)-pent-2-enedioate
diethyl (E)-pent-2-enedioate (PubChem CID 637576) has the molecular formula C9H14O4
and a molecular weight of 186.21 g/mol. Its IUPAC name is diethyl (E)-pent-2-enedioate.
Molecular Properties
| Compound Name | diethyl (E)-pent-2-enedioate |
| PubChem CID | 637576 |
| Molecular Formula | C9H14O4 |
| Molecular Weight | 186.21 g/mol |
| Exact Mass | 186.09 |
| IUPAC Name | diethyl (E)-pent-2-enedioate |
| SMILES | CCOC(=O)/C=C/CC(=O)OCC |
| InChI | InChI=1S/C9H14O4/c1-3-12-8(10)6-5-7-9(11)13-4-2/h5-6H,3-4,7H2,1-2H3/b6-5+ |
| InChIKey | JHCKGVJZNIWNJK-AATRIKPKSA-N |
| XLogP | 1.06 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.21 |
| LogP ≤ 5 | 1.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|
Analyze diethyl (E)-pent-2-enedioate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of diethyl (E)-pent-2-enedioate?
The IUPAC name of diethyl (E)-pent-2-enedioate (CID 637576) is diethyl (E)-pent-2-enedioate.
What is the SMILES notation for diethyl (E)-pent-2-enedioate?
The canonical SMILES for diethyl (E)-pent-2-enedioate is CCOC(=O)/C=C/CC(=O)OCC.
What is the InChIKey of diethyl (E)-pent-2-enedioate?
The InChIKey is JHCKGVJZNIWNJK-AATRIKPKSA-N. The full InChI is InChI=1S/C9H14O4/c1-3-12-8(10)6-5-7-9(11)13-4-2/h5-6H,3-4,7H2,1-2H3/b6-5+.
What are the key properties of diethyl (E)-pent-2-enedioate?
diethyl (E)-pent-2-enedioate has a molecular weight of 186.21 g/mol, XLogP of 1.06, 5 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for diethyl (E)-pent-2-enedioate is sourced from PubChem (CID 637576), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).