C12H11F3N4S — CID 63758455
1,3-dimethyl-5-(3,4,5-trifluoroanilino)pyrazole-4-carbothioamide (PubChem CID 63758455) has the molecular formula C12H11F3N4S and a molecular weight of 300.31 g/mol. Its IUPAC name is 1,3-dimethyl-5-(3,4,5-trifluoroanilino)pyrazole-4-carbothioamide.
| Compound Name | 1,3-dimethyl-5-(3,4,5-trifluoroanilino)pyrazole-4-carbothioamide |
|---|---|
| PubChem CID | 63758455 |
| Molecular Formula | C12H11F3N4S |
| Molecular Weight | 300.31 g/mol |
| Exact Mass | 300.07 |
| IUPAC Name | 1,3-dimethyl-5-(3,4,5-trifluoroanilino)pyrazole-4-carbothioamide |
| SMILES | Cc1nn(C)c(Nc2cc(F)c(F)c(F)c2)c1C(N)=S |
| InChI | InChI=1S/C12H11F3N4S/c1-5-9(11(16)20)12(19(2)18-5)17-6-3-7(13)10(15)8(14)4-6/h3-4,17H,1-2H3,(H2,16,20) |
| InChIKey | HPCSPFCQXYRMNE-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 55.87 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.31 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|