C8H10F3N3OS — CID 63758793
1,3-dimethyl-5-(2,2,2-trifluoroethoxy)pyrazole-4-carbothioamide (PubChem CID 63758793) has the molecular formula C8H10F3N3OS and a molecular weight of 253.25 g/mol. Its IUPAC name is 1,3-dimethyl-5-(2,2,2-trifluoroethoxy)pyrazole-4-carbothioamide.
| Compound Name | 1,3-dimethyl-5-(2,2,2-trifluoroethoxy)pyrazole-4-carbothioamide |
|---|---|
| PubChem CID | 63758793 |
| Molecular Formula | C8H10F3N3OS |
| Molecular Weight | 253.25 g/mol |
| Exact Mass | 253.05 |
| IUPAC Name | 1,3-dimethyl-5-(2,2,2-trifluoroethoxy)pyrazole-4-carbothioamide |
| SMILES | Cc1nn(C)c(OCC(F)(F)F)c1C(N)=S |
| InChI | InChI=1S/C8H10F3N3OS/c1-4-5(6(12)16)7(14(2)13-4)15-3-8(9,10)11/h3H2,1-2H3,(H2,12,16) |
| InChIKey | FHJADCJJAGNVAS-UHFFFAOYSA-N |
| XLogP | 1.30 |
| TPSA | 53.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 253.25 |
| LogP ≤ 5 | 1.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|