About 1-cyclopropyl-N'-(1-methyltetrazol-5-yl)ethane-1,2-diamine
1-cyclopropyl-N'-(1-methyltetrazol-5-yl)ethane-1,2-diamine (PubChem CID 63758915) has the molecular formula C7H14N6
and a molecular weight of 182.23 g/mol. Its IUPAC name is 1-cyclopropyl-N'-(1-methyltetrazol-5-yl)ethane-1,2-diamine.
Molecular Properties
| Compound Name | 1-cyclopropyl-N'-(1-methyltetrazol-5-yl)ethane-1,2-diamine |
| PubChem CID | 63758915 |
| Molecular Formula | C7H14N6 |
| Molecular Weight | 182.23 g/mol |
| Exact Mass | 182.13 |
| IUPAC Name | 1-cyclopropyl-N'-(1-methyltetrazol-5-yl)ethane-1,2-diamine |
| SMILES | Cn1nnnc1NCC(N)C1CC1 |
| InChI | InChI=1S/C7H14N6/c1-13-7(10-11-12-13)9-4-6(8)5-2-3-5/h5-6H,2-4,8H2,1H3,(H,9,10,12) |
| InChIKey | PSRKOEZFVQJALZ-UHFFFAOYSA-N |
| XLogP | -0.64 |
| TPSA | 81.65 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.23 |
| LogP ≤ 5 | -0.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze 1-cyclopropyl-N'-(1-methyltetrazol-5-yl)ethane-1,2-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-cyclopropyl-N'-(1-methyltetrazol-5-yl)ethane-1,2-diamine?
The IUPAC name of 1-cyclopropyl-N'-(1-methyltetrazol-5-yl)ethane-1,2-diamine (CID 63758915) is 1-cyclopropyl-N'-(1-methyltetrazol-5-yl)ethane-1,2-diamine.
What is the SMILES notation for 1-cyclopropyl-N'-(1-methyltetrazol-5-yl)ethane-1,2-diamine?
The canonical SMILES for 1-cyclopropyl-N'-(1-methyltetrazol-5-yl)ethane-1,2-diamine is Cn1nnnc1NCC(N)C1CC1.
What is the InChIKey of 1-cyclopropyl-N'-(1-methyltetrazol-5-yl)ethane-1,2-diamine?
The InChIKey is PSRKOEZFVQJALZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H14N6/c1-13-7(10-11-12-13)9-4-6(8)5-2-3-5/h5-6H,2-4,8H2,1H3,(H,9,10,12).
What are the key properties of 1-cyclopropyl-N'-(1-methyltetrazol-5-yl)ethane-1,2-diamine?
1-cyclopropyl-N'-(1-methyltetrazol-5-yl)ethane-1,2-diamine has a molecular weight of 182.23 g/mol, XLogP of -0.64, 4 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for 1-cyclopropyl-N'-(1-methyltetrazol-5-yl)ethane-1,2-diamine is sourced from PubChem (CID 63758915), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).