C7H13N5O2 — CID 63759750
6-[2-aminopropyl(methyl)amino]-2H-1,2,4-triazine-3,5-dione (PubChem CID 63759750) has the molecular formula C7H13N5O2 and a molecular weight of 199.21 g/mol. Its IUPAC name is 6-[2-aminopropyl(methyl)amino]-2H-1,2,4-triazine-3,5-dione.
| Compound Name | 6-[2-aminopropyl(methyl)amino]-2H-1,2,4-triazine-3,5-dione |
|---|---|
| PubChem CID | 63759750 |
| Molecular Formula | C7H13N5O2 |
| Molecular Weight | 199.21 g/mol |
| Exact Mass | 199.11 |
| IUPAC Name | 6-[2-aminopropyl(methyl)amino]-2H-1,2,4-triazine-3,5-dione |
| SMILES | CC(N)CN(C)c1n[nH]c(=O)[nH]c1=O |
| InChI | InChI=1S/C7H13N5O2/c1-4(8)3-12(2)5-6(13)9-7(14)11-10-5/h4H,3,8H2,1-2H3,(H2,9,11,13,14) |
| InChIKey | SWTMUTJPZHJEKZ-UHFFFAOYSA-N |
| XLogP | -1.76 |
| TPSA | 107.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.21 |
| LogP ≤ 5 | -1.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |