C8H19N3O — CID 63760672
2-[2-aminopropyl(methyl)amino]-N-methylpropanamide (PubChem CID 63760672) has the molecular formula C8H19N3O and a molecular weight of 173.26 g/mol. Its IUPAC name is 2-[2-aminopropyl(methyl)amino]-N-methylpropanamide.
| Compound Name | 2-[2-aminopropyl(methyl)amino]-N-methylpropanamide |
|---|---|
| PubChem CID | 63760672 |
| Molecular Formula | C8H19N3O |
| Molecular Weight | 173.26 g/mol |
| Exact Mass | 173.15 |
| IUPAC Name | 2-[2-aminopropyl(methyl)amino]-N-methylpropanamide |
| SMILES | CNC(=O)C(C)N(C)CC(C)N |
| InChI | InChI=1S/C8H19N3O/c1-6(9)5-11(4)7(2)8(12)10-3/h6-7H,5,9H2,1-4H3,(H,10,12) |
| InChIKey | XOLOOHZJTBFQGY-UHFFFAOYSA-N |
| XLogP | -0.60 |
| TPSA | 58.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 173.26 |
| LogP ≤ 5 | -0.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |