C13H19F3N2 — CID 63760833
2-ethyl-2-N-[4-(trifluoromethyl)phenyl]butane-1,2-diamine (PubChem CID 63760833) has the molecular formula C13H19F3N2 and a molecular weight of 260.30 g/mol. Its IUPAC name is 2-ethyl-2-N-[4-(trifluoromethyl)phenyl]butane-1,2-diamine.
| Compound Name | 2-ethyl-2-N-[4-(trifluoromethyl)phenyl]butane-1,2-diamine |
|---|---|
| PubChem CID | 63760833 |
| Molecular Formula | C13H19F3N2 |
| Molecular Weight | 260.30 g/mol |
| Exact Mass | 260.15 |
| IUPAC Name | 2-ethyl-2-N-[4-(trifluoromethyl)phenyl]butane-1,2-diamine |
| SMILES | CCC(CC)(CN)Nc1ccc(C(F)(F)F)cc1 |
| InChI | InChI=1S/C13H19F3N2/c1-3-12(4-2,9-17)18-11-7-5-10(6-8-11)13(14,15)16/h5-8,18H,3-4,9,17H2,1-2H3 |
| InChIKey | CWBYRSCOFQYOAN-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 260.30 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |