C15H27N3O2S — CID 63761398
4-[(1-amino-4-methylpentan-2-yl)amino]-N-propan-2-ylbenzenesulfonamide (PubChem CID 63761398) has the molecular formula C15H27N3O2S and a molecular weight of 313.47 g/mol. Its IUPAC name is 4-[(1-amino-4-methylpentan-2-yl)amino]-N-propan-2-ylbenzenesulfonamide.
| Compound Name | 4-[(1-amino-4-methylpentan-2-yl)amino]-N-propan-2-ylbenzenesulfonamide |
|---|---|
| PubChem CID | 63761398 |
| Molecular Formula | C15H27N3O2S |
| Molecular Weight | 313.47 g/mol |
| Exact Mass | 313.18 |
| IUPAC Name | 4-[(1-amino-4-methylpentan-2-yl)amino]-N-propan-2-ylbenzenesulfonamide |
| SMILES | CC(C)CC(CN)Nc1ccc(S(=O)(=O)NC(C)C)cc1 |
| InChI | InChI=1S/C15H27N3O2S/c1-11(2)9-14(10-16)17-13-5-7-15(8-6-13)21(19,20)18-12(3)4/h5-8,11-12,14,17-18H,9-10,16H2,1-4H3 |
| InChIKey | QWWDSTWYBUOJBS-UHFFFAOYSA-N |
| XLogP | 2.16 |
| TPSA | 84.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.47 |
| LogP ≤ 5 | 2.16 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |