C17H20ClNO2 — CID 63762769
(3-chloro-8-azabicyclo[3.2.1]octan-8-yl)-(3,4-dihydro-2H-chromen-4-yl)methanone (PubChem CID 63762769) has the molecular formula C17H20ClNO2 and a molecular weight of 305.80 g/mol. Its IUPAC name is (3-chloro-8-azabicyclo[3.2.1]octan-8-yl)-(3,4-dihydro-2H-chromen-4-yl)methanone.
| Compound Name | (3-chloro-8-azabicyclo[3.2.1]octan-8-yl)-(3,4-dihydro-2H-chromen-4-yl)methanone |
|---|---|
| PubChem CID | 63762769 |
| Molecular Formula | C17H20ClNO2 |
| Molecular Weight | 305.80 g/mol |
| Exact Mass | 305.12 |
| IUPAC Name | (3-chloro-8-azabicyclo[3.2.1]octan-8-yl)-(3,4-dihydro-2H-chromen-4-yl)methanone |
| SMILES | O=C(C1CCOc2ccccc21)N1C2CCC1CC(Cl)C2 |
| InChI | InChI=1S/C17H20ClNO2/c18-11-9-12-5-6-13(10-11)19(12)17(20)15-7-8-21-16-4-2-1-3-14(15)16/h1-4,11-13,15H,5-10H2 |
| InChIKey | BOEXEOZIXKRLBY-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 29.54 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 305.80 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|