About 8-[(3,5-dimethyl-1H-pyrazol-4-yl)sulfonyl]-8-azabicyclo[3.2.1]octan-3-ol
8-[(3,5-dimethyl-1H-pyrazol-4-yl)sulfonyl]-8-azabicyclo[3.2.1]octan-3-ol (PubChem CID 63764411) has the molecular formula C12H19N3O3S
and a molecular weight of 285.37 g/mol. Its IUPAC name is 8-[(3,5-dimethyl-1H-pyrazol-4-yl)sulfonyl]-8-azabicyclo[3.2.1]octan-3-ol.
Molecular Properties
| Compound Name | 8-[(3,5-dimethyl-1H-pyrazol-4-yl)sulfonyl]-8-azabicyclo[3.2.1]octan-3-ol |
| PubChem CID | 63764411 |
| Molecular Formula | C12H19N3O3S |
| Molecular Weight | 285.37 g/mol |
| Exact Mass | 285.11 |
| IUPAC Name | 8-[(3,5-dimethyl-1H-pyrazol-4-yl)sulfonyl]-8-azabicyclo[3.2.1]octan-3-ol |
| SMILES | Cc1n[nH]c(C)c1S(=O)(=O)N1C2CCC1CC(O)C2 |
| InChI | InChI=1S/C12H19N3O3S/c1-7-12(8(2)14-13-7)19(17,18)15-9-3-4-10(15)6-11(16)5-9/h9-11,16H,3-6H2,1-2H3,(H,13,14) |
| InChIKey | AAXKBHCDAJDPKZ-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 86.29 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 19 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 285.37 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze 8-[(3,5-dimethyl-1H-pyrazol-4-yl)sulfonyl]-8-azabicyclo[3.2.1]octan-3-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 8-[(3,5-dimethyl-1H-pyrazol-4-yl)sulfonyl]-8-azabicyclo[3.2.1]octan-3-ol?
The IUPAC name of 8-[(3,5-dimethyl-1H-pyrazol-4-yl)sulfonyl]-8-azabicyclo[3.2.1]octan-3-ol (CID 63764411) is 8-[(3,5-dimethyl-1H-pyrazol-4-yl)sulfonyl]-8-azabicyclo[3.2.1]octan-3-ol.
What is the SMILES notation for 8-[(3,5-dimethyl-1H-pyrazol-4-yl)sulfonyl]-8-azabicyclo[3.2.1]octan-3-ol?
The canonical SMILES for 8-[(3,5-dimethyl-1H-pyrazol-4-yl)sulfonyl]-8-azabicyclo[3.2.1]octan-3-ol is Cc1n[nH]c(C)c1S(=O)(=O)N1C2CCC1CC(O)C2.
What is the InChIKey of 8-[(3,5-dimethyl-1H-pyrazol-4-yl)sulfonyl]-8-azabicyclo[3.2.1]octan-3-ol?
The InChIKey is AAXKBHCDAJDPKZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H19N3O3S/c1-7-12(8(2)14-13-7)19(17,18)15-9-3-4-10(15)6-11(16)5-9/h9-11,16H,3-6H2,1-2H3,(H,13,14).
What are the key properties of 8-[(3,5-dimethyl-1H-pyrazol-4-yl)sulfonyl]-8-azabicyclo[3.2.1]octan-3-ol?
8-[(3,5-dimethyl-1H-pyrazol-4-yl)sulfonyl]-8-azabicyclo[3.2.1]octan-3-ol has a molecular weight of 285.37 g/mol, XLogP of 0.70, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 8-[(3,5-dimethyl-1H-pyrazol-4-yl)sulfonyl]-8-azabicyclo[3.2.1]octan-3-ol is sourced from PubChem (CID 63764411), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).