C8H10FN3O2S — CID 63764885
1-[(5-fluoro-3-pyridinyl)sulfonyl]azetidin-3-amine (PubChem CID 63764885) has the molecular formula C8H10FN3O2S and a molecular weight of 231.25 g/mol. Its IUPAC name is 1-[(5-fluoro-3-pyridinyl)sulfonyl]azetidin-3-amine.
| Compound Name | 1-[(5-fluoro-3-pyridinyl)sulfonyl]azetidin-3-amine |
|---|---|
| PubChem CID | 63764885 |
| Molecular Formula | C8H10FN3O2S |
| Molecular Weight | 231.25 g/mol |
| Exact Mass | 231.05 |
| IUPAC Name | 1-[(5-fluoro-3-pyridinyl)sulfonyl]azetidin-3-amine |
| SMILES | NC1CN(S(=O)(=O)c2cncc(F)c2)C1 |
| InChI | InChI=1S/C8H10FN3O2S/c9-6-1-8(3-11-2-6)15(13,14)12-4-7(10)5-12/h1-3,7H,4-5,10H2 |
| InChIKey | FKOSHXWORPPCLQ-UHFFFAOYSA-N |
| XLogP | -0.45 |
| TPSA | 76.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 231.25 |
| LogP ≤ 5 | -0.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |