About 4-isothiocyanatobenzoyl chloride
4-isothiocyanatobenzoyl chloride (PubChem CID 637654) has the molecular formula C8H4ClNOS
and a molecular weight of 197.65 g/mol. Its IUPAC name is 4-isothiocyanatobenzoyl chloride.
Molecular Properties
| Compound Name | 4-isothiocyanatobenzoyl chloride |
| PubChem CID | 637654 |
| Molecular Formula | C8H4ClNOS |
| Molecular Weight | 197.65 g/mol |
| Exact Mass | 196.97 |
| IUPAC Name | 4-isothiocyanatobenzoyl chloride |
| SMILES | O=C(Cl)c1ccc(N=C=S)cc1 |
| InChI | InChI=1S/C8H4ClNOS/c9-8(11)6-1-3-7(4-2-6)10-5-12/h1-4H |
| InChIKey | WPRKKGAKYQGUBI-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 29.43 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 197.65 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'acid_halide', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 4-isothiocyanatobenzoyl chloride with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-isothiocyanatobenzoyl chloride?
The IUPAC name of 4-isothiocyanatobenzoyl chloride (CID 637654) is 4-isothiocyanatobenzoyl chloride.
What is the SMILES notation for 4-isothiocyanatobenzoyl chloride?
The canonical SMILES for 4-isothiocyanatobenzoyl chloride is O=C(Cl)c1ccc(N=C=S)cc1.
What is the InChIKey of 4-isothiocyanatobenzoyl chloride?
The InChIKey is WPRKKGAKYQGUBI-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H4ClNOS/c9-8(11)6-1-3-7(4-2-6)10-5-12/h1-4H.
What are the key properties of 4-isothiocyanatobenzoyl chloride?
4-isothiocyanatobenzoyl chloride has a molecular weight of 197.65 g/mol, XLogP of 2.80, 2 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-isothiocyanatobenzoyl chloride is sourced from PubChem (CID 637654), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).