C15H24N4O — CID 63766258
4-[2-(2-aminoethyl)piperidin-1-yl]-N-ethylpyridine-2-carboxamide (PubChem CID 63766258) has the molecular formula C15H24N4O and a molecular weight of 276.38 g/mol. Its IUPAC name is 4-[2-(2-aminoethyl)piperidin-1-yl]-N-ethylpyridine-2-carboxamide.
| Compound Name | 4-[2-(2-aminoethyl)piperidin-1-yl]-N-ethylpyridine-2-carboxamide |
|---|---|
| PubChem CID | 63766258 |
| Molecular Formula | C15H24N4O |
| Molecular Weight | 276.38 g/mol |
| Exact Mass | 276.20 |
| IUPAC Name | 4-[2-(2-aminoethyl)piperidin-1-yl]-N-ethylpyridine-2-carboxamide |
| SMILES | CCNC(=O)c1cc(N2CCCCC2CCN)ccn1 |
| InChI | InChI=1S/C15H24N4O/c1-2-17-15(20)14-11-13(7-9-18-14)19-10-4-3-5-12(19)6-8-16/h7,9,11-12H,2-6,8,10,16H2,1H3,(H,17,20) |
| InChIKey | HTRMIZMTXYBYBS-UHFFFAOYSA-N |
| XLogP | 1.54 |
| TPSA | 71.25 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.38 |
| LogP ≤ 5 | 1.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |