About N-(2-aminopropyl)-1,1-difluoro-N-methylmethanesulfonamide
N-(2-aminopropyl)-1,1-difluoro-N-methylmethanesulfonamide (PubChem CID 63767532) has the molecular formula C5H12F2N2O2S
and a molecular weight of 202.23 g/mol. Its IUPAC name is N-(2-aminopropyl)-1,1-difluoro-N-methylmethanesulfonamide.
Molecular Properties
| Compound Name | N-(2-aminopropyl)-1,1-difluoro-N-methylmethanesulfonamide |
| PubChem CID | 63767532 |
| Molecular Formula | C5H12F2N2O2S |
| Molecular Weight | 202.23 g/mol |
| Exact Mass | 202.06 |
| IUPAC Name | N-(2-aminopropyl)-1,1-difluoro-N-methylmethanesulfonamide |
| SMILES | CC(N)CN(C)S(=O)(=O)C(F)F |
| InChI | InChI=1S/C5H12F2N2O2S/c1-4(8)3-9(2)12(10,11)5(6)7/h4-5H,3,8H2,1-2H3 |
| InChIKey | XBXAHAUEPIMQPI-UHFFFAOYSA-N |
| XLogP | -0.18 |
| TPSA | 63.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.23 |
| LogP ≤ 5 | -0.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-(2-aminopropyl)-1,1-difluoro-N-methylmethanesulfonamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(2-aminopropyl)-1,1-difluoro-N-methylmethanesulfonamide?
The IUPAC name of N-(2-aminopropyl)-1,1-difluoro-N-methylmethanesulfonamide (CID 63767532) is N-(2-aminopropyl)-1,1-difluoro-N-methylmethanesulfonamide.
What is the SMILES notation for N-(2-aminopropyl)-1,1-difluoro-N-methylmethanesulfonamide?
The canonical SMILES for N-(2-aminopropyl)-1,1-difluoro-N-methylmethanesulfonamide is CC(N)CN(C)S(=O)(=O)C(F)F.
What is the InChIKey of N-(2-aminopropyl)-1,1-difluoro-N-methylmethanesulfonamide?
The InChIKey is XBXAHAUEPIMQPI-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H12F2N2O2S/c1-4(8)3-9(2)12(10,11)5(6)7/h4-5H,3,8H2,1-2H3.
What are the key properties of N-(2-aminopropyl)-1,1-difluoro-N-methylmethanesulfonamide?
N-(2-aminopropyl)-1,1-difluoro-N-methylmethanesulfonamide has a molecular weight of 202.23 g/mol, XLogP of -0.18, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(2-aminopropyl)-1,1-difluoro-N-methylmethanesulfonamide is sourced from PubChem (CID 63767532), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).